Manufacturer supply top purity 4-(Xylylazo)xylidine 62072-89-3 with ISO standards
- Molecular Formula: C16H21N3
- Molecular Weight: 255.358
- Vapor Pressure: 2.43E-06mmHg at 25°C
- Boiling Point: 391.6°Cat760mmHg
- Flash Point: 190.6°C
- Density: 1.05g/cm3
4-(Xylylazo)xylidine(Cas 62072-89-3) Usage
|
General Description |
4-(Xylylazo)xylidine, also known as C.I. Solvent Orange 7, is a chemical compound that belongs to the azo dye family. It is commonly used as a dye in the textile industry, particularly for coloring nylon, silk, and wool. As a solvent dye, it is soluble in organic solvents such as alcohols and hydrocarbons, making it suitable for use in various industries. However, it has limited solubility in water. The compound is recognized for its bright orange color, which makes it popular for dyeing fabrics and coloring various products. Additionally, it is often used in the manufacturing of inks, plastics, and coatings. The chemical is known for its low toxicity and is generally considered safe for use in consumer products. However, like many azo dyes, 4-(Xylylazo)xylidine has the potential to break down into aromatic amines, some of which have raised health concerns and regulatory attention. Therefore, it is important to handle and use this chemical with care and follow safety guidelines to minimize any potential risks. |
InChI:InChI=1/C16H21N3/c1-11-5-6-15(12(2)9-11)18-19-16(4)8-7-14(17)13(3)10-16/h5-7,9-10H,8,17H2,1-4H3/b19-18+