What is the Methyl 4-bromocrotonate?

Methyl 4-bromocrotonate is clear yellow liquid, while it's Molecular Formula is C5H7BrO2. clear yellow liquid It is a useful synthetic intermediate. It was used in the synthesis of irreversible inhibitors of EGFR and HER-2 tyrosine kinases with enhanced antitumor activities.

What is the CAS number for Methyl 4-bromocrotonate?

The CAS number of Methyl 4-bromocrotonate is 1117-71-1.

What is Methyl 4-bromocrotonate (1117-71-1) used for?

Methyl 4-bromocrotonate is a clear yellow liquid that serves as a valuable synthetic intermediate in the chemical industry. Its unique chemical structure allows it to be utilized in the synthesis of various compounds, particularly in the development of irreversible inhibitors targeting EGFR and HER-2 tyrosine kinases, which are crucial in the treatment of certain types of cancer.InChI:InChI=1/C5H7BrO2/c1-8-5(7)3-2-4-6/h2-3H,4H2,1H3/b3-2-

What is the Methyl 4-bromocrotonate?

Methyl 4-bromocrotonate is clear yellow liquid, while it's Molecular Formula is C5H7BrO2. clear yellow liquid It is a useful synthetic intermediate. It was used in the synthesis of irreversible inhibitors of EGFR and HER-2 tyrosine kinases with enhanced antitumor activities.

What is the CAS number for Methyl 4-bromocrotonate?

The CAS number of Methyl 4-bromocrotonate is 1117-71-1.

What is Methyl 4-bromocrotonate (1117-71-1) used for?

Methyl 4-bromocrotonate is a clear yellow liquid that serves as a valuable synthetic intermediate in the chemical industry. Its unique chemical structure allows it to be utilized in the synthesis of various compounds, particularly in the development of irreversible inhibitors targeting EGFR and HER-2 tyrosine kinases, which are crucial in the treatment of certain types of cancer.InChI:InChI=1/C5H7BrO2/c1-8-5(7)3-2-4-6/h2-3H,4H2,1H3/b3-2-