What is the N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide?

N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide is white to light yellow powder, while it's Molecular Formula is C9H9 N5 O S. white to light yellow powder N-(3-(5-Mercapto-1H-tetrazol-1-yl)phenyl)acetamide (cas# 14070-48-5) is used in the stabilizing solution, in the method for preparing electrically-?conductive silver images

What is the N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide?

N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide is white to light yellow powder, while it's Molecular Formula is C9H9 N5 O S. white to light yellow powder N-(3-(5-Mercapto-1H-tetrazol-1-yl)phenyl)acetamide (cas# 14070-48-5) is used in the stabilizing solution, in the method for preparing electrically-?conductive silver images

Quality Factory Supply 99% Pure N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide 14070-48-5 with Efficient Delivery

Q: What is the CAS number for N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide?

The CAS number of N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide is 14070-48-5.

Q: What is N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide (14070-48-5) used for?

N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide, with the CAS number 14070-48-5, is an organic compound characterized by its unique chemical structure that features a phenyl group attached to a 5-mercapto-1H-1,2,3,4-tetraazol-1-yl group and an acetamide functional group. N-[3-(5-Mercapto-1H-1,2,3,4-tetraazol-1-yl)phenyl]acetamide is known for its potential applications in various fields due to its chemical properties.InChI:InChI=1/C9H9N5OS/c1-6(15)10-7-3-2-4-8(5-7)14-9(16)11-12-13-14/h2-5H,1H3,(H,10,15)(H,11,13,16)