What is the 3-CHLOROBENZAL BROMIDE?

3-CHLOROBENZAL BROMIDE is , while it's Molecular Formula is C7H5 Br2 Cl. Used in Pharmaceutical Industry: 3-Chlorobenzal bromide is used as a key intermediate for the synthesis of various pharmaceuticals. Its reactivity in nucleophilic substitution and halogenation reactions allows for the creation of a wide range of medicinal compounds, contributing to the development of new drugs and therapies. Used in Agrochemical Industry: In the agrochemical sector, 3-Chlorobenzal bromide is utilized as an intermediate in the production of different agrochemicals. Its chemical properties facilitate the synthesis of compounds that can be used in the development of pesticides, herbicides, and other agricultural products to improve crop protection and yield. Used in Organic Chemistry Research: 3-Chlorobenzal bromide is employed as a reagent in organic chemistry research. Its ability to undergo multiple types of chemical reactions makes it a valuable tool for exploring new synthetic pathways and developing novel organic compounds for various applications. Used in Industrial Applications: The versatile nature of 3-Chlorobenzal bromide makes it suitable for use in various industrial applications. Its role in the synthesis of organic compounds contributes to the production of specialty chemicals, dyes, and other products that are essential across different industries.

What is the CAS number for 3-CHLOROBENZAL BROMIDE?

The CAS number of 3-CHLOROBENZAL BROMIDE is 62037-06-3.

What is 3-CHLOROBENZAL BROMIDE (62037-06-3) used for?

3-Chlorobenzal bromide, with the molecular formula C7H4BrClO, is a pale yellow solid chemical compound. It serves as an intermediate in the production of pharmaceuticals and agrochemicals, and is valued for its ability to participate in various reactions such as nucleophilic substitution and halogenation. Its versatility makes it a crucial tool in organic chemistry research and industrial applications. However, due to its high toxicity and corrosive nature, careful handling is essential.InChI:InChI=1/C7H5Br2Cl/c8-7(9)5-1-3-6(10)4-2-5/h1-4,7H

What is the 3-CHLOROBENZAL BROMIDE?

3-CHLOROBENZAL BROMIDE is , while it's Molecular Formula is C7H5 Br2 Cl. Used in Pharmaceutical Industry: 3-Chlorobenzal bromide is used as a key intermediate for the synthesis of various pharmaceuticals. Its reactivity in nucleophilic substitution and halogenation reactions allows for the creation of a wide range of medicinal compounds, contributing to the development of new drugs and therapies. Used in Agrochemical Industry: In the agrochemical sector, 3-Chlorobenzal bromide is utilized as an intermediate in the production of different agrochemicals. Its chemical properties facilitate the synthesis of compounds that can be used in the development of pesticides, herbicides, and other agricultural products to improve crop protection and yield. Used in Organic Chemistry Research: 3-Chlorobenzal bromide is employed as a reagent in organic chemistry research. Its ability to undergo multiple types of chemical reactions makes it a valuable tool for exploring new synthetic pathways and developing novel organic compounds for various applications. Used in Industrial Applications: The versatile nature of 3-Chlorobenzal bromide makes it suitable for use in various industrial applications. Its role in the synthesis of organic compounds contributes to the production of specialty chemicals, dyes, and other products that are essential across different industries.

What is the CAS number for 3-CHLOROBENZAL BROMIDE?

The CAS number of 3-CHLOROBENZAL BROMIDE is 62037-06-3.

What is 3-CHLOROBENZAL BROMIDE (62037-06-3) used for?

3-Chlorobenzal bromide, with the molecular formula C7H4BrClO, is a pale yellow solid chemical compound. It serves as an intermediate in the production of pharmaceuticals and agrochemicals, and is valued for its ability to participate in various reactions such as nucleophilic substitution and halogenation. Its versatility makes it a crucial tool in organic chemistry research and industrial applications. However, due to its high toxicity and corrosive nature, careful handling is essential.InChI:InChI=1/C7H5Br2Cl/c8-7(9)5-1-3-6(10)4-2-5/h1-4,7H

Perfect Factory Offer Excellent quality 3-CHLOROBENZAL BROMIDE 62037-06-3 with Safe Shipping

3-CHLOROBENZAL BROMIDE

CAS No.: 62037-06-3
Purity: 99%

Perfect Factory Offer Excellent quality 3-CHLOROBENZAL BROMIDE 62037-06-3 with Safe Shipping

Molecular Formula: C7H5 Br2 Cl
Molecular Weight: 284.378
Vapor Pressure: 0.0105mmHg at 25°C
Melting Point: 64-66 °C
Boiling Point: 264 °C
Flash Point: 134.2°C
PSA： 0.00000
Density: 1.93
LogP: 4.12840

3-CHLOROBENZAL BROMIDE(Cas 62037-06-3) Usage

General Description

3-Chlorobenzal bromide is a chemical compound with the molecular formula C7H4BrClO. It is a pale yellow solid that is used as an intermediate in the production of various pharmaceuticals and agrochemicals. 3-Chlorobenzal bromide is known for its ability to undergo various reactions, including nucleophilic substitution and halogenation reactions. It is also used as a reagent in the synthesis of a variety of organic compounds, and its versatile nature makes it a valuable tool in organic chemistry research and industrial applications. However, it is important to handle 3-Chlorobenzal bromide with caution as it is a highly toxic and corrosive compound.

InChI:InChI=1/C7H5Br2Cl/c8-7(9)5-1-3-6(10)4-2-5/h1-4,7H